C9H8INO — CID 23444684
5-iodo-4-methyl-1,3-dihydroindol-2-one (PubChem CID 23444684) has the molecular formula C9H8INO and a molecular weight of 273.07 g/mol. Its IUPAC name is 5-iodo-4-methyl-1,3-dihydroindol-2-one.
| Compound Name | 5-iodo-4-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 23444684 |
| Molecular Formula | C9H8INO |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 5-iodo-4-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1c(I)ccc2c1CC(=O)N2 |
| InChI | InChI=1S/C9H8INO/c1-5-6-4-9(12)11-8(6)3-2-7(5)10/h2-3H,4H2,1H3,(H,11,12) |
| InChIKey | FYMGXBGSTYKVGE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|