About 4-(bromomethyl)-1,3-dihydroindol-2-one
4-(bromomethyl)-1,3-dihydroindol-2-one (PubChem CID 90008900) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 4-(bromomethyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 4-(bromomethyl)-1,3-dihydroindol-2-one |
| PubChem CID | 90008900 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 4-(bromomethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2c(CBr)cccc2N1 |
| InChI | InChI=1S/C9H8BrNO/c10-5-6-2-1-3-8-7(6)4-9(12)11-8/h1-3H,4-5H2,(H,11,12) |
| InChIKey | GZSCSZMHKSIWCZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-1,3-dihydroindol-2-one?
The IUPAC name of 4-(bromomethyl)-1,3-dihydroindol-2-one (CID 90008900) is 4-(bromomethyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 4-(bromomethyl)-1,3-dihydroindol-2-one?
The canonical SMILES for 4-(bromomethyl)-1,3-dihydroindol-2-one is O=C1Cc2c(CBr)cccc2N1.
What is the InChIKey of 4-(bromomethyl)-1,3-dihydroindol-2-one?
The InChIKey is GZSCSZMHKSIWCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c10-5-6-2-1-3-8-7(6)4-9(12)11-8/h1-3H,4-5H2,(H,11,12).
What are the key properties of 4-(bromomethyl)-1,3-dihydroindol-2-one?
4-(bromomethyl)-1,3-dihydroindol-2-one has a molecular weight of 226.07 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 90008900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).