C12H13NO2 — CID 117291451
3-(2-oxo-1,3-dihydroindol-4-yl)butanal (PubChem CID 117291451) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(2-oxo-1,3-dihydroindol-4-yl)butanal.
| Compound Name | 3-(2-oxo-1,3-dihydroindol-4-yl)butanal |
|---|---|
| PubChem CID | 117291451 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(2-oxo-1,3-dihydroindol-4-yl)butanal |
| SMILES | CC(CC=O)c1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C12H13NO2/c1-8(5-6-14)9-3-2-4-11-10(9)7-12(15)13-11/h2-4,6,8H,5,7H2,1H3,(H,13,15) |
| InChIKey | OGWCLIUFYALXAT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|