C26H25NO2 — CID 57129320
5-ethyl-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one (PubChem CID 57129320) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 5-ethyl-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | 5-ethyl-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57129320 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5-ethyl-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one |
| SMILES | CCc1ccc2c(c1)C(=Cc1oc3c(c1-c1ccc(C)cc1)CCCC3)C(=O)N2 |
| InChI | InChI=1S/C26H25NO2/c1-3-17-10-13-22-20(14-17)21(26(28)27-22)15-24-25(18-11-8-16(2)9-12-18)19-6-4-5-7-23(19)29-24/h8-15H,3-7H2,1-2H3,(H,27,28) |
| InChIKey | GSKHMWRJVHRZBB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|