C24H19NO4 — CID 57188893
2-oxo-3-[(3-phenyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indole-5-carboxylic acid (PubChem CID 57188893) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-oxo-3-[(3-phenyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indole-5-carboxylic acid.
| Compound Name | 2-oxo-3-[(3-phenyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 57188893 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-oxo-3-[(3-phenyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indole-5-carboxylic acid |
| SMILES | O=C1Nc2ccc(C(=O)O)cc2C1=Cc1oc2c(c1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C24H19NO4/c26-23-18(17-12-15(24(27)28)10-11-19(17)25-23)13-21-22(14-6-2-1-3-7-14)16-8-4-5-9-20(16)29-21/h1-3,6-7,10-13H,4-5,8-9H2,(H,25,26)(H,27,28) |
| InChIKey | DRDSBUWCXQPIQQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|