C19H18INO2 — CID 57153956
3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-5-iodo-1H-indol-2-one (PubChem CID 57153956) has the molecular formula C19H18INO2 and a molecular weight of 419.26 g/mol. Its IUPAC name is 3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-5-iodo-1H-indol-2-one.
| Compound Name | 3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-5-iodo-1H-indol-2-one |
|---|---|
| PubChem CID | 57153956 |
| Molecular Formula | C19H18INO2 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-5-iodo-1H-indol-2-one |
| SMILES | CCc1c(C=C2C(=O)Nc3ccc(I)cc32)oc2c1CCCC2 |
| InChI | InChI=1S/C19H18INO2/c1-2-12-13-5-3-4-6-17(13)23-18(12)10-15-14-9-11(20)7-8-16(14)21-19(15)22/h7-10H,2-6H2,1H3,(H,21,22) |
| InChIKey | CFGNNBYYPPZBLU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|