C24H22N2O2 — CID 57015297
5-amino-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one (PubChem CID 57015297) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-amino-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | 5-amino-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57015297 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 5-amino-3-[[3-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1ccc(-c2c(C=C3C(=O)Nc4ccc(N)cc43)oc3c2CCCC3)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-14-6-8-15(9-7-14)23-17-4-2-3-5-21(17)28-22(23)13-19-18-12-16(25)10-11-20(18)26-24(19)27/h6-13H,2-5,25H2,1H3,(H,26,27) |
| InChIKey | AIMBETJFEDNQOU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|