C22H22ClNO4 — CID 57113292
ethyl 2-[[5-(2-chloroethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (PubChem CID 57113292) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is ethyl 2-[[5-(2-chloroethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-[[5-(2-chloroethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 57113292 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | ethyl 2-[[5-(2-chloroethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C=C2C(=O)Nc3ccc(CCCl)cc32)oc2c1CCCC2 |
| InChI | InChI=1S/C22H22ClNO4/c1-2-27-22(26)20-14-5-3-4-6-18(14)28-19(20)12-16-15-11-13(9-10-23)7-8-17(15)24-21(16)25/h7-8,11-12H,2-6,9-10H2,1H3,(H,24,25) |
| InChIKey | NJFWMWLPICOGSJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|