C19H19NO2 — CID 57163442
3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57163442) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57163442 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one |
| SMILES | CCc1c(C=C2C(=O)Nc3ccccc32)oc2c1CCCC2 |
| InChI | InChI=1S/C19H19NO2/c1-2-12-14-8-4-6-10-17(14)22-18(12)11-15-13-7-3-5-9-16(13)20-19(15)21/h3,5,7,9,11H,2,4,6,8,10H2,1H3,(H,20,21) |
| InChIKey | IPRJFBRNQMUYSW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|