C27H24N2O4 — CID 57117414
N-[3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indol-5-yl]-4-formylbenzamide (PubChem CID 57117414) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indol-5-yl]-4-formylbenzamide.
| Compound Name | N-[3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indol-5-yl]-4-formylbenzamide |
|---|---|
| PubChem CID | 57117414 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[3-[(3-ethyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indol-5-yl]-4-formylbenzamide |
| SMILES | CCc1c(C=C2C(=O)Nc3ccc(NC(=O)c4ccc(C=O)cc4)cc32)oc2c1CCCC2 |
| InChI | InChI=1S/C27H24N2O4/c1-2-19-20-5-3-4-6-24(20)33-25(19)14-22-21-13-18(11-12-23(21)29-27(22)32)28-26(31)17-9-7-16(15-30)8-10-17/h7-15H,2-6H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | NQDJUXKNRXJCRI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|