C26H32N2O5S — CID 57139652
5-morpholin-4-ylsulfonyl-3-[(3-pentyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57139652) has the molecular formula C26H32N2O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-3-[(3-pentyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-morpholin-4-ylsulfonyl-3-[(3-pentyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57139652 |
| Molecular Formula | C26H32N2O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-3-[(3-pentyl-4,5,6,7-tetrahydro-1-benzofuran-2-yl)methylidene]-1H-indol-2-one |
| SMILES | CCCCCc1c(C=C2C(=O)Nc3ccc(S(=O)(=O)N4CCOCC4)cc32)oc2c1CCCC2 |
| InChI | InChI=1S/C26H32N2O5S/c1-2-3-4-7-20-19-8-5-6-9-24(19)33-25(20)17-22-21-16-18(10-11-23(21)27-26(22)29)34(30,31)28-12-14-32-15-13-28/h10-11,16-17H,2-9,12-15H2,1H3,(H,27,29) |
| InChIKey | KRUFCJXXEAEWSW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|