C23H15F2N3O3 — CID 91176462
3-[(3,4-difluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-4-ylmethyl)-1H-quinoline-6-carboxamide (PubChem CID 91176462) has the molecular formula C23H15F2N3O3 and a molecular weight of 419.39 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-4-ylmethyl)-1H-quinoline-6-carboxamide.
| Compound Name | 3-[(3,4-difluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-4-ylmethyl)-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 91176462 |
| Molecular Formula | C23H15F2N3O3 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methylidene]-2,4-dioxo-N-(pyridin-4-ylmethyl)-1H-quinoline-6-carboxamide |
| SMILES | O=C1Nc2ccc(C(=O)NCc3ccncc3)cc2C(=O)C1=Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H15F2N3O3/c24-18-3-1-14(10-19(18)25)9-17-21(29)16-11-15(2-4-20(16)28-23(17)31)22(30)27-12-13-5-7-26-8-6-13/h1-11H,12H2,(H,27,30)(H,28,31) |
| InChIKey | HQERIIDOIGSYLF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|