C17H10Br2INO4 — CID 175429105
[2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenyl] ethaneperoxoate (PubChem CID 175429105) has the molecular formula C17H10Br2INO4 and a molecular weight of 578.98 g/mol. Its IUPAC name is [2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenyl] ethaneperoxoate.
| Compound Name | [2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 175429105 |
| Molecular Formula | C17H10Br2INO4 |
| Molecular Weight | 578.98 g/mol |
| Exact Mass | 576.80 |
| IUPAC Name | [2,6-dibromo-4-[(5-iodo-2-oxo-1H-indol-3-ylidene)methyl]phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1c(Br)cc(C=C2C(=O)Nc3ccc(I)cc32)cc1Br |
| InChI | InChI=1S/C17H10Br2INO4/c1-8(22)24-25-16-13(18)5-9(6-14(16)19)4-12-11-7-10(20)2-3-15(11)21-17(12)23/h2-7H,1H3,(H,21,23) |
| InChIKey | OIMFHIWRQJHSNY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|