C16H8N2O8 — CID 142641677
1-amino-4-nitro-9,10-dioxoanthracene-2,6-dicarboxylic acid (PubChem CID 142641677) has the molecular formula C16H8N2O8 and a molecular weight of 356.25 g/mol. Its IUPAC name is 1-amino-4-nitro-9,10-dioxoanthracene-2,6-dicarboxylic acid.
| Compound Name | 1-amino-4-nitro-9,10-dioxoanthracene-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 142641677 |
| Molecular Formula | C16H8N2O8 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1-amino-4-nitro-9,10-dioxoanthracene-2,6-dicarboxylic acid |
| SMILES | Nc1c(C(=O)O)cc([N+](=O)[O-])c2c1C(=O)c1ccc(C(=O)O)cc1C2=O |
| InChI | InChI=1S/C16H8N2O8/c17-12-8(16(23)24)4-9(18(25)26)10-11(12)13(19)6-2-1-5(15(21)22)3-7(6)14(10)20/h1-4H,17H2,(H,21,22)(H,23,24) |
| InChIKey | WXZWJYQFXKDPAY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|