C14H8ClN3O9S — CID 88774409
1-amino-4,6-dinitro-9,10-dioxoanthracene-2-sulfonic acid;hydrochloride (PubChem CID 88774409) has the molecular formula C14H8ClN3O9S and a molecular weight of 429.75 g/mol. Its IUPAC name is 1-amino-4,6-dinitro-9,10-dioxoanthracene-2-sulfonic acid;hydrochloride.
| Compound Name | 1-amino-4,6-dinitro-9,10-dioxoanthracene-2-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 88774409 |
| Molecular Formula | C14H8ClN3O9S |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | 1-amino-4,6-dinitro-9,10-dioxoanthracene-2-sulfonic acid;hydrochloride |
| SMILES | Cl.Nc1c(S(=O)(=O)O)cc([N+](=O)[O-])c2c1C(=O)c1ccc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C14H7N3O9S.ClH/c15-12-9(27(24,25)26)4-8(17(22)23)10-11(12)13(18)6-2-1-5(16(20)21)3-7(6)14(10)19;/h1-4H,15H2,(H,24,25,26);1H |
| InChIKey | TYIVTUYJPODXJJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 200.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|