C14H8FNNaO8S2+ — CID 71496331
sodium 1-amino-4-fluoro-9,10-dioxoanthracene-2,6-disulfonic acid (PubChem CID 71496331) has the molecular formula C14H8FNNaO8S2+ and a molecular weight of 424.34 g/mol. Its IUPAC name is sodium 1-amino-4-fluoro-9,10-dioxoanthracene-2,6-disulfonic acid.
| Compound Name | sodium 1-amino-4-fluoro-9,10-dioxoanthracene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 71496331 |
| Molecular Formula | C14H8FNNaO8S2+ |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | sodium 1-amino-4-fluoro-9,10-dioxoanthracene-2,6-disulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(F)c2c1C(=O)c1ccc(S(=O)(=O)O)cc1C2=O.[Na+] |
| InChI | InChI=1S/C14H8FNO8S2.Na/c15-8-4-9(26(22,23)24)12(16)11-10(8)14(18)7-3-5(25(19,20)21)1-2-6(7)13(11)17;/h1-4H,16H2,(H,19,20,21)(H,22,23,24);/q;+1 |
| InChIKey | ZYGMEWVJNAZNKS-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|