C14H7NNa2O8S2 — CID 44784328
disodium;1-amino-9,10-dioxoanthracene-2,6-disulfonate (PubChem CID 44784328) has the molecular formula C14H7NNa2O8S2 and a molecular weight of 427.32 g/mol. Its IUPAC name is disodium;1-amino-9,10-dioxoanthracene-2,6-disulfonate.
| Compound Name | disodium;1-amino-9,10-dioxoanthracene-2,6-disulfonate |
|---|---|
| PubChem CID | 44784328 |
| Molecular Formula | C14H7NNa2O8S2 |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | disodium;1-amino-9,10-dioxoanthracene-2,6-disulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])ccc2c1C(=O)c1ccc(S(=O)(=O)[O-])cc1C2=O.[Na+].[Na+] |
| InChI | InChI=1S/C14H9NO8S2.2Na/c15-12-10(25(21,22)23)4-3-8-11(12)14(17)7-2-1-6(24(18,19)20)5-9(7)13(8)16;;/h1-5H,15H2,(H,18,19,20)(H,21,22,23);;/q;2*+1/p-2 |
| InChIKey | MOWQGAAXSKRMSY-UHFFFAOYSA-L |
| XLogP | -6.14 |
| TPSA | 174.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|