C14H7ClN2O7S — CID 23463683
1-amino-6-chloro-4-nitro-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 23463683) has the molecular formula C14H7ClN2O7S and a molecular weight of 382.74 g/mol. Its IUPAC name is 1-amino-6-chloro-4-nitro-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-6-chloro-4-nitro-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 23463683 |
| Molecular Formula | C14H7ClN2O7S |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 1-amino-6-chloro-4-nitro-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc([N+](=O)[O-])c2c1C(=O)c1ccc(Cl)cc1C2=O |
| InChI | InChI=1S/C14H7ClN2O7S/c15-5-1-2-6-7(3-5)14(19)10-8(17(20)21)4-9(25(22,23)24)12(16)11(10)13(6)18/h1-4H,16H2,(H,22,23,24) |
| InChIKey | YKOGCKWXLPARQR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|