C14H6ClN3O8S — CID 54005549
1-amino-4,8-dinitro-9,10-dioxoanthracene-2-sulfonyl chloride (PubChem CID 54005549) has the molecular formula C14H6ClN3O8S and a molecular weight of 411.74 g/mol. Its IUPAC name is 1-amino-4,8-dinitro-9,10-dioxoanthracene-2-sulfonyl chloride.
| Compound Name | 1-amino-4,8-dinitro-9,10-dioxoanthracene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 54005549 |
| Molecular Formula | C14H6ClN3O8S |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | 1-amino-4,8-dinitro-9,10-dioxoanthracene-2-sulfonyl chloride |
| SMILES | Nc1c(S(=O)(=O)Cl)cc([N+](=O)[O-])c2c1C(=O)c1c(cccc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C14H6ClN3O8S/c15-27(25,26)8-4-7(18(23)24)10-11(12(8)16)14(20)9-5(13(10)19)2-1-3-6(9)17(21)22/h1-4H,16H2 |
| InChIKey | KOPXFXCIOMRWGH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 180.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|