C14H8BrN3O4 — CID 23455965
1,4-diamino-2-bromo-6-nitroanthracene-9,10-dione (PubChem CID 23455965) has the molecular formula C14H8BrN3O4 and a molecular weight of 362.14 g/mol. Its IUPAC name is 1,4-diamino-2-bromo-6-nitroanthracene-9,10-dione.
| Compound Name | 1,4-diamino-2-bromo-6-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 23455965 |
| Molecular Formula | C14H8BrN3O4 |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 1,4-diamino-2-bromo-6-nitroanthracene-9,10-dione |
| SMILES | Nc1cc(Br)c(N)c2c1C(=O)c1cc([N+](=O)[O-])ccc1C2=O |
| InChI | InChI=1S/C14H8BrN3O4/c15-8-4-9(16)10-11(12(8)17)13(19)6-2-1-5(18(21)22)3-7(6)14(10)20/h1-4H,16-17H2 |
| InChIKey | QXMBZXKAEXRXFV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|