C14H9F2IO2 — CID 123301985
4-(2,4-difluoro-5-iodophenyl)-3-methylbenzoic acid (PubChem CID 123301985) has the molecular formula C14H9F2IO2 and a molecular weight of 374.12 g/mol. Its IUPAC name is 4-(2,4-difluoro-5-iodophenyl)-3-methylbenzoic acid.
| Compound Name | 4-(2,4-difluoro-5-iodophenyl)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 123301985 |
| Molecular Formula | C14H9F2IO2 |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 4-(2,4-difluoro-5-iodophenyl)-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1cc(I)c(F)cc1F |
| InChI | InChI=1S/C14H9F2IO2/c1-7-4-8(14(18)19)2-3-9(7)10-5-13(17)12(16)6-11(10)15/h2-6H,1H3,(H,18,19) |
| InChIKey | UFFGJXFJMQKQHB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|