C10H10O3S — CID 169006023
3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxylic acid (PubChem CID 169006023) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxylic acid.
| Compound Name | 3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxylic acid |
|---|---|
| PubChem CID | 169006023 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)SCCOC2 |
| InChI | InChI=1S/C10H10O3S/c11-10(12)7-1-2-8-6-13-3-4-14-9(8)5-7/h1-2,5H,3-4,6H2,(H,11,12) |
| InChIKey | VLTNZMLTRNJVNT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |