About (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid
(4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid (PubChem CID 131098619) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid |
| PubChem CID | 131098619 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid |
| SMILES | N[C@H]1COCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C10H11NO3/c11-9-5-14-4-7-3-6(10(12)13)1-2-8(7)9/h1-3,9H,4-5,11H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | HEKWSQPDMKEIPD-VIFPVBQESA-N |
| XLogP | 0.91 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid?
The IUPAC name of (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid (CID 131098619) is (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid.
What is the SMILES notation for (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid?
The canonical SMILES for (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid is N[C@H]1COCc2cc(C(=O)O)ccc21.
What is the InChIKey of (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid?
The InChIKey is HEKWSQPDMKEIPD-VIFPVBQESA-N. The full InChI is InChI=1S/C10H11NO3/c11-9-5-14-4-7-3-6(10(12)13)1-2-8(7)9/h1-3,9H,4-5,11H2,(H,12,13)/t9-/m0/s1.
What are the key properties of (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid?
(4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid has a molecular weight of 193.20 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-3,4-dihydro-1H-isochromene-7-carboxylic acid is sourced from PubChem (CID 131098619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).