C16H15NO3 — CID 107148944
4-(3,4-dihydro-1H-isochromen-4-ylamino)benzoic acid (PubChem CID 107148944) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isochromen-4-ylamino)benzoic acid.
| Compound Name | 4-(3,4-dihydro-1H-isochromen-4-ylamino)benzoic acid |
|---|---|
| PubChem CID | 107148944 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-(3,4-dihydro-1H-isochromen-4-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC2COCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15NO3/c18-16(19)11-5-7-13(8-6-11)17-15-10-20-9-12-3-1-2-4-14(12)15/h1-8,15,17H,9-10H2,(H,18,19) |
| InChIKey | LJSYWZFGDPKNKW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |