C15H14BrNO — CID 107148809
N-(3-bromophenyl)-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 107148809) has the molecular formula C15H14BrNO and a molecular weight of 304.19 g/mol. Its IUPAC name is N-(3-bromophenyl)-3,4-dihydro-1H-isochromen-4-amine.
| Compound Name | N-(3-bromophenyl)-3,4-dihydro-1H-isochromen-4-amine |
|---|---|
| PubChem CID | 107148809 |
| Molecular Formula | C15H14BrNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(3-bromophenyl)-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | Brc1cccc(NC2COCc3ccccc32)c1 |
| InChI | InChI=1S/C15H14BrNO/c16-12-5-3-6-13(8-12)17-15-10-18-9-11-4-1-2-7-14(11)15/h1-8,15,17H,9-10H2 |
| InChIKey | SQBSUAASJCSLIW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |