C20H30O7 — CID 23276908
1-(3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-yl)ethanone (PubChem CID 23276908) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is 1-(3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-yl)ethanone.
| Compound Name | 1-(3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-yl)ethanone |
|---|---|
| PubChem CID | 23276908 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-(3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)COCCOCCOCCOCCOCCOC2 |
| InChI | InChI=1S/C20H30O7/c1-17(21)18-2-3-19-15-26-12-10-24-8-6-22-4-5-23-7-9-25-11-13-27-16-20(19)14-18/h2-3,14H,4-13,15-16H2,1H3 |
| InChIKey | YCLNPRKGJZWUIQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |