C10H14N2OS — CID 116998988
2-amino-2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)ethanol (PubChem CID 116998988) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-amino-2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)ethanol.
| Compound Name | 2-amino-2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)ethanol |
|---|---|
| PubChem CID | 116998988 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-amino-2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)ethanol |
| SMILES | NC(CO)c1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C10H14N2OS/c11-8(6-13)7-1-2-9-10(5-7)14-4-3-12-9/h1-2,5,8,12-13H,3-4,6,11H2 |
| InChIKey | ALFIQNQVZPZRDO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |