C13H19NOS — CID 116999090
2-(3,4-dihydro-2H-1,4-benzothiazin-7-ylmethyl)butan-1-ol (PubChem CID 116999090) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,4-benzothiazin-7-ylmethyl)butan-1-ol.
| Compound Name | 2-(3,4-dihydro-2H-1,4-benzothiazin-7-ylmethyl)butan-1-ol |
|---|---|
| PubChem CID | 116999090 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,4-benzothiazin-7-ylmethyl)butan-1-ol |
| SMILES | CCC(CO)Cc1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C13H19NOS/c1-2-10(9-15)7-11-3-4-12-13(8-11)16-6-5-14-12/h3-4,8,10,14-15H,2,5-7,9H2,1H3 |
| InChIKey | FDVOPLTUEQDHQI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |