C14H19NO2S — CID 116930804
6-[2-(hydroxymethyl)butyl]-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 116930804) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)butyl]-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[2-(hydroxymethyl)butyl]-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116930804 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-[2-(hydroxymethyl)butyl]-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CCC(CO)Cc1ccc2c(c1)NC(=O)C(C)S2 |
| InChI | InChI=1S/C14H19NO2S/c1-3-10(8-16)6-11-4-5-13-12(7-11)15-14(17)9(2)18-13/h4-5,7,9-10,16H,3,6,8H2,1-2H3,(H,15,17) |
| InChIKey | IVPHVDDHNOUIRU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |