C16H20N2O2S — CID 110771581
N-cyclopentyl-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide (PubChem CID 110771581) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is N-cyclopentyl-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 110771581 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-cyclopentyl-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
| SMILES | CC1Sc2ccc(CC(=O)NC3CCCC3)cc2NC1=O |
| InChI | InChI=1S/C16H20N2O2S/c1-10-16(20)18-13-8-11(6-7-14(13)21-10)9-15(19)17-12-4-2-3-5-12/h6-8,10,12H,2-5,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | UMDMYKLGMYKDCB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |