C11H16N4OS — CID 115260828
6-[(hydrazinylmethylamino)methyl]-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 115260828) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 6-[(hydrazinylmethylamino)methyl]-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[(hydrazinylmethylamino)methyl]-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115260828 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 6-[(hydrazinylmethylamino)methyl]-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2ccc(CNCNN)cc2NC1=O |
| InChI | InChI=1S/C11H16N4OS/c1-7-11(16)15-9-4-8(5-13-6-14-12)2-3-10(9)17-7/h2-4,7,13-14H,5-6,12H2,1H3,(H,15,16) |
| InChIKey | VSDSVDPCGWPASB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|