C12H17N3OS — CID 115226094
6-[2-(aminomethylamino)ethyl]-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 115226094) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-[2-(aminomethylamino)ethyl]-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[2-(aminomethylamino)ethyl]-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115226094 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 6-[2-(aminomethylamino)ethyl]-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2ccc(CCNCN)cc2NC1=O |
| InChI | InChI=1S/C12H17N3OS/c1-8-12(16)15-10-6-9(4-5-14-7-13)2-3-11(10)17-8/h2-3,6,8,14H,4-5,7,13H2,1H3,(H,15,16) |
| InChIKey | WESCXQDZDAOUNJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|