C18H15N3O2S — CID 110771646
N-(2-cyanophenyl)-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide (PubChem CID 110771646) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 110771646 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
| SMILES | CC1Sc2ccc(CC(=O)Nc3ccccc3C#N)cc2NC1=O |
| InChI | InChI=1S/C18H15N3O2S/c1-11-18(23)21-15-8-12(6-7-16(15)24-11)9-17(22)20-14-5-3-2-4-13(14)10-19/h2-8,11H,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BEXQTTDAODTJOR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |