C19H21N3O3S — CID 98450060
(2R)-2-cyano-N-cyclohexyl-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]-3-oxopropanamide (PubChem CID 98450060) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is (2R)-2-cyano-N-cyclohexyl-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]-3-oxopropanamide.
| Compound Name | (2R)-2-cyano-N-cyclohexyl-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 98450060 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (2R)-2-cyano-N-cyclohexyl-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]-3-oxopropanamide |
| SMILES | C[C@H]1Sc2ccc(C(=O)[C@@H](C#N)C(=O)NC3CCCCC3)cc2NC1=O |
| InChI | InChI=1S/C19H21N3O3S/c1-11-18(24)22-15-9-12(7-8-16(15)26-11)17(23)14(10-20)19(25)21-13-5-3-2-4-6-13/h7-9,11,13-14H,2-6H2,1H3,(H,21,25)(H,22,24)/t11-,14-/m1/s1 |
| InChIKey | IJCRTPFSXRGPBV-BXUZGUMPSA-N |
| XLogP | 2.89 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|