C13H18N2O2S — CID 116861466
6-(1-amino-4-hydroxybutyl)-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 116861466) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-(1-amino-4-hydroxybutyl)-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(1-amino-4-hydroxybutyl)-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116861466 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-(1-amino-4-hydroxybutyl)-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2ccc(C(N)CCCO)cc2NC1=O |
| InChI | InChI=1S/C13H18N2O2S/c1-8-13(17)15-11-7-9(4-5-12(11)18-8)10(14)3-2-6-16/h4-5,7-8,10,16H,2-3,6,14H2,1H3,(H,15,17) |
| InChIKey | DMCATRFELVMJKD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |