About 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid
1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid (PubChem CID 115096119) has the molecular formula C9H9NO4S
and a molecular weight of 227.24 g/mol. Its IUPAC name is 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid.
Analyze 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid?
The IUPAC name of 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid (CID 115096119) is 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid.
What is the SMILES notation for 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid?
The canonical SMILES for 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid is O=C(O)c1ccc2c(c1)S(=O)(=O)CCN2.
What is the InChIKey of 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid?
The InChIKey is HVLSJCFVJZUFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4S/c11-9(12)6-1-2-7-8(5-6)15(13,14)4-3-10-7/h1-2,5,10H,3-4H2,(H,11,12).
What are the key properties of 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid?
1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid has a molecular weight of 227.24 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-7-carboxylic acid is sourced from PubChem (CID 115096119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).