C11H13NO2 — CID 96624717
2,3,4,5,7,9-hexahydrofuro[3,4-h][1,5]benzoxazepine (PubChem CID 96624717) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,3,4,5,7,9-hexahydrofuro[3,4-h][1,5]benzoxazepine.
| Compound Name | 2,3,4,5,7,9-hexahydrofuro[3,4-h][1,5]benzoxazepine |
|---|---|
| PubChem CID | 96624717 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,3,4,5,7,9-hexahydrofuro[3,4-h][1,5]benzoxazepine |
| SMILES | c1c2c(cc3c1NCCCO3)COC2 |
| InChI | InChI=1S/C11H13NO2/c1-2-12-10-4-8-6-13-7-9(8)5-11(10)14-3-1/h4-5,12H,1-3,6-7H2 |
| InChIKey | SKNQCKOLFLDFLY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |