About 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine
1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine (PubChem CID 176695160) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine.
Analyze 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine?
The IUPAC name of 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine (CID 176695160) is 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine.
What is the SMILES notation for 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine?
The canonical SMILES for 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine is Nc1cnc2c(c1)NCCCO2.
What is the InChIKey of 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine?
The InChIKey is WTSYBWGKCZWYLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c9-6-4-7-8(11-5-6)12-3-1-2-10-7/h4-5,10H,1-3,9H2.
What are the key properties of 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine?
1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine has a molecular weight of 165.20 g/mol, XLogP of 0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrahydropyrido[2,3-b][1,4]oxazepin-8-amine is sourced from PubChem (CID 176695160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).