About ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate
ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate (PubChem CID 131337609) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate.
Analyze ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate?
The IUPAC name of ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate (CID 131337609) is ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate.
What is the SMILES notation for ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate?
The canonical SMILES for ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate is CCOC(=O)c1cnc2c(c1)NCCO2.
What is the InChIKey of ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate?
The InChIKey is FGLUBRQCJLLOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c1-2-14-10(13)7-5-8-9(12-6-7)15-4-3-11-8/h5-6,11H,2-4H2,1H3.
What are the key properties of ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate?
ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate has a molecular weight of 208.22 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carboxylate is sourced from PubChem (CID 131337609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).