C11H14N2O2 — CID 131559753
ethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-3-carboxylate (PubChem CID 131559753) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is ethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 131559753 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethyl 5,6,7,8-tetrahydro-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1)NCCC2 |
| InChI | InChI=1S/C11H14N2O2/c1-2-15-11(14)8-6-10-9(13-7-8)4-3-5-12-10/h6-7,12H,2-5H2,1H3 |
| InChIKey | AUVYEPXMNBAEFC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |