About 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine
7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (PubChem CID 126971931) has the molecular formula C7H7FN2O
and a molecular weight of 154.14 g/mol. Its IUPAC name is 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
Analyze 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The IUPAC name of 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (CID 126971931) is 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
What is the SMILES notation for 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The canonical SMILES for 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine is Fc1cnc2c(c1)NCCO2.
What is the InChIKey of 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The InChIKey is WZEDOJDXFVJZBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O/c8-5-3-6-7(10-4-5)11-2-1-9-6/h3-4,9H,1-2H2.
What are the key properties of 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine has a molecular weight of 154.14 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine is sourced from PubChem (CID 126971931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).