C11H10N2O — CID 21353728
2,3-dihydro-1H-pyrido[3,2-g][1,4]benzoxazine (PubChem CID 21353728) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrido[3,2-g][1,4]benzoxazine.
| Compound Name | 2,3-dihydro-1H-pyrido[3,2-g][1,4]benzoxazine |
|---|---|
| PubChem CID | 21353728 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2,3-dihydro-1H-pyrido[3,2-g][1,4]benzoxazine |
| SMILES | c1cnc2cc3c(cc2c1)NCCO3 |
| InChI | InChI=1S/C11H10N2O/c1-2-8-6-10-11(14-5-4-13-10)7-9(8)12-3-1/h1-3,6-7,13H,4-5H2 |
| InChIKey | AYBQJEDJYPKKPD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |