About oxirane;quinoline
oxirane;quinoline (PubChem CID 157282028) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is oxirane;quinoline.
Molecular Properties
| Compound Name | oxirane;quinoline |
| PubChem CID | 157282028 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | oxirane;quinoline |
| SMILES | C1CO1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H4O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-1/h1-7H;1-2H2 |
| InChIKey | AZTVMSNZEYFMCP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;quinoline?
The IUPAC name of oxirane;quinoline (CID 157282028) is oxirane;quinoline.
What is the SMILES notation for oxirane;quinoline?
The canonical SMILES for oxirane;quinoline is C1CO1.c1ccc2ncccc2c1.
What is the InChIKey of oxirane;quinoline?
The InChIKey is AZTVMSNZEYFMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H4O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-1/h1-7H;1-2H2.
What are the key properties of oxirane;quinoline?
oxirane;quinoline has a molecular weight of 173.22 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;quinoline is sourced from PubChem (CID 157282028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).