C8H10N2O2 — CID 141190538
3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-7-ylmethanol (PubChem CID 141190538) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-7-ylmethanol.
| Compound Name | 3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-7-ylmethanol |
|---|---|
| PubChem CID | 141190538 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-7-ylmethanol |
| SMILES | OCc1cc2c(cn1)NCCO2 |
| InChI | InChI=1S/C8H10N2O2/c11-5-6-3-8-7(4-10-6)9-1-2-12-8/h3-4,9,11H,1-2,5H2 |
| InChIKey | BTIFYIZVIVDXBM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |