About 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride
2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride (PubChem CID 164886209) has the molecular formula C7H9ClN2O
and a molecular weight of 172.62 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride.
Analyze 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride?
The IUPAC name of 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride (CID 164886209) is 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride.
What is the SMILES notation for 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride?
The canonical SMILES for 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride is Cl.c1cc2c(cn1)OCCN2.
What is the InChIKey of 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride?
The InChIKey is DZEZNCKZILBVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.ClH/c1-2-8-5-7-6(1)9-3-4-10-7;/h1-2,5,9H,3-4H2;1H.
What are the key properties of 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride?
2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride has a molecular weight of 172.62 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine;hydrochloride is sourced from PubChem (CID 164886209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).