C13H11ClN2O — CID 162441455
7-(3-chlorophenyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine (PubChem CID 162441455) has the molecular formula C13H11ClN2O and a molecular weight of 246.70 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine.
| Compound Name | 7-(3-chlorophenyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 162441455 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 7-(3-chlorophenyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine |
| SMILES | Clc1cccc(-c2cc3c(cn2)OCCN3)c1 |
| InChI | InChI=1S/C13H11ClN2O/c14-10-3-1-2-9(6-10)11-7-12-13(8-16-11)17-5-4-15-12/h1-3,6-8,15H,4-5H2 |
| InChIKey | MWZATWNNSAWUIP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |