C11H12ClN4+ — CID 136719721
3-(3-chlorophenyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium (PubChem CID 136719721) has the molecular formula C11H12ClN4+ and a molecular weight of 235.70 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium.
| Compound Name | 3-(3-chlorophenyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 136719721 |
| Molecular Formula | C11H12ClN4+ |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-(3-chlorophenyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrimidin-4-ium |
| SMILES | Clc1cccc(-c2[nH]nc3[n+]2CCCN3)c1 |
| InChI | InChI=1S/C11H11ClN4/c12-9-4-1-3-8(7-9)10-14-15-11-13-5-2-6-16(10)11/h1,3-4,7H,2,5-6H2,(H,13,15)/p+1 |
| InChIKey | GZIUKSJSYBEOSD-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 44.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|