C10H10ClN4+ — CID 136719696
3-(3-chlorophenyl)-2,5,6,7-tetrahydroimidazo[2,1-c][1,2,4]triazol-4-ium (PubChem CID 136719696) has the molecular formula C10H10ClN4+ and a molecular weight of 221.67 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2,5,6,7-tetrahydroimidazo[2,1-c][1,2,4]triazol-4-ium.
| Compound Name | 3-(3-chlorophenyl)-2,5,6,7-tetrahydroimidazo[2,1-c][1,2,4]triazol-4-ium |
|---|---|
| PubChem CID | 136719696 |
| Molecular Formula | C10H10ClN4+ |
| Molecular Weight | 221.67 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-(3-chlorophenyl)-2,5,6,7-tetrahydroimidazo[2,1-c][1,2,4]triazol-4-ium |
| SMILES | Clc1cccc(-c2[nH]nc3[n+]2CCN3)c1 |
| InChI | InChI=1S/C10H9ClN4/c11-8-3-1-2-7(6-8)9-13-14-10-12-4-5-15(9)10/h1-3,6H,4-5H2,(H,12,14)/p+1 |
| InChIKey | PBNFMYPIWKDRCW-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 44.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|