About 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine
6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine (PubChem CID 171499086) has the molecular formula C13H9ClN2
and a molecular weight of 228.68 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 171499086 |
| Molecular Formula | C13H9ClN2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Clc1cccc(-c2cc3[nH]ccc3cn2)c1 |
| InChI | InChI=1S/C13H9ClN2/c14-11-3-1-2-9(6-11)12-7-13-10(8-16-12)4-5-15-13/h1-8,15H |
| InChIKey | JDVNGXFQJINIBM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine (CID 171499086) is 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine is Clc1cccc(-c2cc3[nH]ccc3cn2)c1.
What is the InChIKey of 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is JDVNGXFQJINIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN2/c14-11-3-1-2-9(6-11)12-7-13-10(8-16-12)4-5-15-13/h1-8,15H.
What are the key properties of 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine?
6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 228.68 g/mol, XLogP of 3.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chlorophenyl)-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 171499086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).