C13H8Cl2N2 — CID 156781518
4-chloro-5-(3-chlorophenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 156781518) has the molecular formula C13H8Cl2N2 and a molecular weight of 263.13 g/mol. Its IUPAC name is 4-chloro-5-(3-chlorophenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-5-(3-chlorophenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 156781518 |
| Molecular Formula | C13H8Cl2N2 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 4-chloro-5-(3-chlorophenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1cccc(-c2cnc3[nH]ccc3c2Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2/c14-9-3-1-2-8(6-9)11-7-17-13-10(12(11)15)4-5-16-13/h1-7H,(H,16,17) |
| InChIKey | DGUOHDNYAUEKAP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |